C13H22BrNOS — CID 66002474
1-(5-bromothiophen-2-yl)-2-methyl-4-(2-methylpropylamino)butan-2-ol (PubChem CID 66002474) has the molecular formula C13H22BrNOS and a molecular weight of 320.30 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)-2-methyl-4-(2-methylpropylamino)butan-2-ol.
| Compound Name | 1-(5-bromothiophen-2-yl)-2-methyl-4-(2-methylpropylamino)butan-2-ol |
|---|---|
| PubChem CID | 66002474 |
| Molecular Formula | C13H22BrNOS |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)-2-methyl-4-(2-methylpropylamino)butan-2-ol |
| SMILES | CC(C)CNCCC(C)(O)Cc1ccc(Br)s1 |
| InChI | InChI=1S/C13H22BrNOS/c1-10(2)9-15-7-6-13(3,16)8-11-4-5-12(14)17-11/h4-5,10,15-16H,6-9H2,1-3H3 |
| InChIKey | CNMYBSYPAAYNIG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|