C16H26BrNO2 — CID 66001084
1-(3-bromo-4-methoxyphenyl)-2-methyl-4-(2-methylpropylamino)butan-2-ol (PubChem CID 66001084) has the molecular formula C16H26BrNO2 and a molecular weight of 344.29 g/mol. Its IUPAC name is 1-(3-bromo-4-methoxyphenyl)-2-methyl-4-(2-methylpropylamino)butan-2-ol.
| Compound Name | 1-(3-bromo-4-methoxyphenyl)-2-methyl-4-(2-methylpropylamino)butan-2-ol |
|---|---|
| PubChem CID | 66001084 |
| Molecular Formula | C16H26BrNO2 |
| Molecular Weight | 344.29 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 1-(3-bromo-4-methoxyphenyl)-2-methyl-4-(2-methylpropylamino)butan-2-ol |
| SMILES | COc1ccc(CC(C)(O)CCNCC(C)C)cc1Br |
| InChI | InChI=1S/C16H26BrNO2/c1-12(2)11-18-8-7-16(3,19)10-13-5-6-15(20-4)14(17)9-13/h5-6,9,12,18-19H,7-8,10-11H2,1-4H3 |
| InChIKey | ZPEDZQZJEIPUEU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.29 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|