C16H15BrF2O2 — CID 106273888
2-[(3-bromo-2,6-difluorophenyl)methyl]-2-phenylpropane-1,3-diol (PubChem CID 106273888) has the molecular formula C16H15BrF2O2 and a molecular weight of 357.19 g/mol. Its IUPAC name is 2-[(3-bromo-2,6-difluorophenyl)methyl]-2-phenylpropane-1,3-diol.
| Compound Name | 2-[(3-bromo-2,6-difluorophenyl)methyl]-2-phenylpropane-1,3-diol |
|---|---|
| PubChem CID | 106273888 |
| Molecular Formula | C16H15BrF2O2 |
| Molecular Weight | 357.19 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | 2-[(3-bromo-2,6-difluorophenyl)methyl]-2-phenylpropane-1,3-diol |
| SMILES | OCC(CO)(Cc1c(F)ccc(Br)c1F)c1ccccc1 |
| InChI | InChI=1S/C16H15BrF2O2/c17-13-6-7-14(18)12(15(13)19)8-16(9-20,10-21)11-4-2-1-3-5-11/h1-7,20-21H,8-10H2 |
| InChIKey | WOLCNGXHDHGCJG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.19 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|