C9H8BrClF2S — CID 106274003
1-bromo-3-(2-chloroethylsulfanylmethyl)-2,4-difluorobenzene (PubChem CID 106274003) has the molecular formula C9H8BrClF2S and a molecular weight of 301.58 g/mol. Its IUPAC name is 1-bromo-3-(2-chloroethylsulfanylmethyl)-2,4-difluorobenzene.
| Compound Name | 1-bromo-3-(2-chloroethylsulfanylmethyl)-2,4-difluorobenzene |
|---|---|
| PubChem CID | 106274003 |
| Molecular Formula | C9H8BrClF2S |
| Molecular Weight | 301.58 g/mol |
| Exact Mass | 299.92 |
| IUPAC Name | 1-bromo-3-(2-chloroethylsulfanylmethyl)-2,4-difluorobenzene |
| SMILES | Fc1ccc(Br)c(F)c1CSCCCl |
| InChI | InChI=1S/C9H8BrClF2S/c10-7-1-2-8(12)6(9(7)13)5-14-4-3-11/h1-2H,3-5H2 |
| InChIKey | PZCOWSLAMAKEJE-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.58 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|