C16H15BrF2S — CID 106270278
1-bromo-3-[(3,5-dimethylphenyl)methylsulfanylmethyl]-2,4-difluorobenzene (PubChem CID 106270278) has the molecular formula C16H15BrF2S and a molecular weight of 357.26 g/mol. Its IUPAC name is 1-bromo-3-[(3,5-dimethylphenyl)methylsulfanylmethyl]-2,4-difluorobenzene.
| Compound Name | 1-bromo-3-[(3,5-dimethylphenyl)methylsulfanylmethyl]-2,4-difluorobenzene |
|---|---|
| PubChem CID | 106270278 |
| Molecular Formula | C16H15BrF2S |
| Molecular Weight | 357.26 g/mol |
| Exact Mass | 356.00 |
| IUPAC Name | 1-bromo-3-[(3,5-dimethylphenyl)methylsulfanylmethyl]-2,4-difluorobenzene |
| SMILES | Cc1cc(C)cc(CSCc2c(F)ccc(Br)c2F)c1 |
| InChI | InChI=1S/C16H15BrF2S/c1-10-5-11(2)7-12(6-10)8-20-9-13-15(18)4-3-14(17)16(13)19/h3-7H,8-9H2,1-2H3 |
| InChIKey | AZCNACGOGZWDBQ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.26 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|