C14H11BrF2OS — CID 114166557
1-bromo-2,4-difluoro-3-[(3-methoxyphenyl)sulfanylmethyl]benzene (PubChem CID 114166557) has the molecular formula C14H11BrF2OS and a molecular weight of 345.21 g/mol. Its IUPAC name is 1-bromo-2,4-difluoro-3-[(3-methoxyphenyl)sulfanylmethyl]benzene.
| Compound Name | 1-bromo-2,4-difluoro-3-[(3-methoxyphenyl)sulfanylmethyl]benzene |
|---|---|
| PubChem CID | 114166557 |
| Molecular Formula | C14H11BrF2OS |
| Molecular Weight | 345.21 g/mol |
| Exact Mass | 343.97 |
| IUPAC Name | 1-bromo-2,4-difluoro-3-[(3-methoxyphenyl)sulfanylmethyl]benzene |
| SMILES | COc1cccc(SCc2c(F)ccc(Br)c2F)c1 |
| InChI | InChI=1S/C14H11BrF2OS/c1-18-9-3-2-4-10(7-9)19-8-11-13(16)6-5-12(15)14(11)17/h2-7H,8H2,1H3 |
| InChIKey | LHENAXOBPSAKCJ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.21 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|