C14H19BrF2O — CID 106273091
6-(3-bromo-2,6-difluorophenyl)-2,2-dimethylhexan-3-ol (PubChem CID 106273091) has the molecular formula C14H19BrF2O and a molecular weight of 321.21 g/mol. Its IUPAC name is 6-(3-bromo-2,6-difluorophenyl)-2,2-dimethylhexan-3-ol.
| Compound Name | 6-(3-bromo-2,6-difluorophenyl)-2,2-dimethylhexan-3-ol |
|---|---|
| PubChem CID | 106273091 |
| Molecular Formula | C14H19BrF2O |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 6-(3-bromo-2,6-difluorophenyl)-2,2-dimethylhexan-3-ol |
| SMILES | CC(C)(C)C(O)CCCc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C14H19BrF2O/c1-14(2,3)12(18)6-4-5-9-11(16)8-7-10(15)13(9)17/h7-8,12,18H,4-6H2,1-3H3 |
| InChIKey | FQFILMBPVFXWSU-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|