C14H19BrF2O2 — CID 106266621
1-(3-bromo-2,6-difluorophenyl)-3-ethoxy-3-methylpentan-2-ol (PubChem CID 106266621) has the molecular formula C14H19BrF2O2 and a molecular weight of 337.20 g/mol. Its IUPAC name is 1-(3-bromo-2,6-difluorophenyl)-3-ethoxy-3-methylpentan-2-ol.
| Compound Name | 1-(3-bromo-2,6-difluorophenyl)-3-ethoxy-3-methylpentan-2-ol |
|---|---|
| PubChem CID | 106266621 |
| Molecular Formula | C14H19BrF2O2 |
| Molecular Weight | 337.20 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 1-(3-bromo-2,6-difluorophenyl)-3-ethoxy-3-methylpentan-2-ol |
| SMILES | CCOC(C)(CC)C(O)Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C14H19BrF2O2/c1-4-14(3,19-5-2)12(18)8-9-11(16)7-6-10(15)13(9)17/h6-7,12,18H,4-5,8H2,1-3H3 |
| InChIKey | ORSWBAVLQDUMJY-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.20 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|