C13H15BrF2O2 — CID 106941867
1-(3-bromo-2,6-difluorophenyl)-2-ethoxy-2-methylbutan-1-one (PubChem CID 106941867) has the molecular formula C13H15BrF2O2 and a molecular weight of 321.16 g/mol. Its IUPAC name is 1-(3-bromo-2,6-difluorophenyl)-2-ethoxy-2-methylbutan-1-one.
| Compound Name | 1-(3-bromo-2,6-difluorophenyl)-2-ethoxy-2-methylbutan-1-one |
|---|---|
| PubChem CID | 106941867 |
| Molecular Formula | C13H15BrF2O2 |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 1-(3-bromo-2,6-difluorophenyl)-2-ethoxy-2-methylbutan-1-one |
| SMILES | CCOC(C)(CC)C(=O)c1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C13H15BrF2O2/c1-4-13(3,18-5-2)12(17)10-9(15)7-6-8(14)11(10)16/h6-7H,4-5H2,1-3H3 |
| InChIKey | AIMSCBLNFCGIHH-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|