C16H19BrF2O2 — CID 106941879
(3-bromo-2,6-difluorophenyl)-(1-ethoxycycloheptyl)methanone (PubChem CID 106941879) has the molecular formula C16H19BrF2O2 and a molecular weight of 361.23 g/mol. Its IUPAC name is (3-bromo-2,6-difluorophenyl)-(1-ethoxycycloheptyl)methanone.
| Compound Name | (3-bromo-2,6-difluorophenyl)-(1-ethoxycycloheptyl)methanone |
|---|---|
| PubChem CID | 106941879 |
| Molecular Formula | C16H19BrF2O2 |
| Molecular Weight | 361.23 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | (3-bromo-2,6-difluorophenyl)-(1-ethoxycycloheptyl)methanone |
| SMILES | CCOC1(C(=O)c2c(F)ccc(Br)c2F)CCCCCC1 |
| InChI | InChI=1S/C16H19BrF2O2/c1-2-21-16(9-5-3-4-6-10-16)15(20)13-12(18)8-7-11(17)14(13)19/h7-8H,2-6,9-10H2,1H3 |
| InChIKey | VQBPPVAFZQRVHL-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.23 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|