C15H21BrO4 — CID 103523138
1-(3-bromo-2,4-dimethoxyphenyl)-2-ethoxy-2-methylbutan-1-one (PubChem CID 103523138) has the molecular formula C15H21BrO4 and a molecular weight of 345.23 g/mol. Its IUPAC name is 1-(3-bromo-2,4-dimethoxyphenyl)-2-ethoxy-2-methylbutan-1-one.
| Compound Name | 1-(3-bromo-2,4-dimethoxyphenyl)-2-ethoxy-2-methylbutan-1-one |
|---|---|
| PubChem CID | 103523138 |
| Molecular Formula | C15H21BrO4 |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 1-(3-bromo-2,4-dimethoxyphenyl)-2-ethoxy-2-methylbutan-1-one |
| SMILES | CCOC(C)(CC)C(=O)c1ccc(OC)c(Br)c1OC |
| InChI | InChI=1S/C15H21BrO4/c1-6-15(3,20-7-2)14(17)10-8-9-11(18-4)12(16)13(10)19-5/h8-9H,6-7H2,1-5H3 |
| InChIKey | UVCNTJBUOMCPGY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |