C13H18BrNO3 — CID 103524317
2-amino-1-(3-bromo-2,4-dimethoxyphenyl)-2-methylbutan-1-one (PubChem CID 103524317) has the molecular formula C13H18BrNO3 and a molecular weight of 316.20 g/mol. Its IUPAC name is 2-amino-1-(3-bromo-2,4-dimethoxyphenyl)-2-methylbutan-1-one.
| Compound Name | 2-amino-1-(3-bromo-2,4-dimethoxyphenyl)-2-methylbutan-1-one |
|---|---|
| PubChem CID | 103524317 |
| Molecular Formula | C13H18BrNO3 |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 2-amino-1-(3-bromo-2,4-dimethoxyphenyl)-2-methylbutan-1-one |
| SMILES | CCC(C)(N)C(=O)c1ccc(OC)c(Br)c1OC |
| InChI | InChI=1S/C13H18BrNO3/c1-5-13(2,15)12(16)8-6-7-9(17-3)10(14)11(8)18-4/h6-7H,5,15H2,1-4H3 |
| InChIKey | CUIPOFJAGJEBNK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |