C13H17BrO4 — CID 103523128
1-(3-bromo-2,4-dimethoxyphenyl)-2-methoxybutan-1-one (PubChem CID 103523128) has the molecular formula C13H17BrO4 and a molecular weight of 317.18 g/mol. Its IUPAC name is 1-(3-bromo-2,4-dimethoxyphenyl)-2-methoxybutan-1-one.
| Compound Name | 1-(3-bromo-2,4-dimethoxyphenyl)-2-methoxybutan-1-one |
|---|---|
| PubChem CID | 103523128 |
| Molecular Formula | C13H17BrO4 |
| Molecular Weight | 317.18 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 1-(3-bromo-2,4-dimethoxyphenyl)-2-methoxybutan-1-one |
| SMILES | CCC(OC)C(=O)c1ccc(OC)c(Br)c1OC |
| InChI | InChI=1S/C13H17BrO4/c1-5-9(16-2)12(15)8-6-7-10(17-3)11(14)13(8)18-4/h6-7,9H,5H2,1-4H3 |
| InChIKey | JNHASCLXWBUZTR-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.18 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |