C16H23BrO4 — CID 103523139
1-(3-bromo-2,4-dimethoxyphenyl)-2-ethoxy-2-ethylbutan-1-one (PubChem CID 103523139) has the molecular formula C16H23BrO4 and a molecular weight of 359.26 g/mol. Its IUPAC name is 1-(3-bromo-2,4-dimethoxyphenyl)-2-ethoxy-2-ethylbutan-1-one.
| Compound Name | 1-(3-bromo-2,4-dimethoxyphenyl)-2-ethoxy-2-ethylbutan-1-one |
|---|---|
| PubChem CID | 103523139 |
| Molecular Formula | C16H23BrO4 |
| Molecular Weight | 359.26 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 1-(3-bromo-2,4-dimethoxyphenyl)-2-ethoxy-2-ethylbutan-1-one |
| SMILES | CCOC(CC)(CC)C(=O)c1ccc(OC)c(Br)c1OC |
| InChI | InChI=1S/C16H23BrO4/c1-6-16(7-2,21-8-3)15(18)11-9-10-12(19-4)13(17)14(11)20-5/h9-10H,6-8H2,1-5H3 |
| InChIKey | VPLVSAYAWQQVOH-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.26 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |