C13H17BrF2O2 — CID 106274511
1-(3-bromo-2,6-difluorophenyl)-5-methoxy-4-methylpentan-2-ol (PubChem CID 106274511) has the molecular formula C13H17BrF2O2 and a molecular weight of 323.18 g/mol. Its IUPAC name is 1-(3-bromo-2,6-difluorophenyl)-5-methoxy-4-methylpentan-2-ol.
| Compound Name | 1-(3-bromo-2,6-difluorophenyl)-5-methoxy-4-methylpentan-2-ol |
|---|---|
| PubChem CID | 106274511 |
| Molecular Formula | C13H17BrF2O2 |
| Molecular Weight | 323.18 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 1-(3-bromo-2,6-difluorophenyl)-5-methoxy-4-methylpentan-2-ol |
| SMILES | COCC(C)CC(O)Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C13H17BrF2O2/c1-8(7-18-2)5-9(17)6-10-12(15)4-3-11(14)13(10)16/h3-4,8-9,17H,5-7H2,1-2H3 |
| InChIKey | LOYNAFUJDPSYBA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.18 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|