C13H16BrClF2 — CID 106943580
1-bromo-3-(3-chloro-4,4-dimethylpentyl)-2,4-difluorobenzene (PubChem CID 106943580) has the molecular formula C13H16BrClF2 and a molecular weight of 325.62 g/mol. Its IUPAC name is 1-bromo-3-(3-chloro-4,4-dimethylpentyl)-2,4-difluorobenzene.
| Compound Name | 1-bromo-3-(3-chloro-4,4-dimethylpentyl)-2,4-difluorobenzene |
|---|---|
| PubChem CID | 106943580 |
| Molecular Formula | C13H16BrClF2 |
| Molecular Weight | 325.62 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | 1-bromo-3-(3-chloro-4,4-dimethylpentyl)-2,4-difluorobenzene |
| SMILES | CC(C)(C)C(Cl)CCc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C13H16BrClF2/c1-13(2,3)11(15)7-4-8-10(16)6-5-9(14)12(8)17/h5-6,11H,4,7H2,1-3H3 |
| InChIKey | AGVKRJIEDRKCFU-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.62 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|