C15H19BrF2O — CID 106267664
1-(3-bromo-2,6-difluorophenyl)-3-propylhexan-2-one (PubChem CID 106267664) has the molecular formula C15H19BrF2O and a molecular weight of 333.22 g/mol. Its IUPAC name is 1-(3-bromo-2,6-difluorophenyl)-3-propylhexan-2-one.
| Compound Name | 1-(3-bromo-2,6-difluorophenyl)-3-propylhexan-2-one |
|---|---|
| PubChem CID | 106267664 |
| Molecular Formula | C15H19BrF2O |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 1-(3-bromo-2,6-difluorophenyl)-3-propylhexan-2-one |
| SMILES | CCCC(CCC)C(=O)Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C15H19BrF2O/c1-3-5-10(6-4-2)14(19)9-11-13(17)8-7-12(16)15(11)18/h7-8,10H,3-6,9H2,1-2H3 |
| InChIKey | KKKYHXLSLOFDCL-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|