C11H11F2NO4 — CID 65065447
2-[carboxymethyl-[(3,4-difluorophenyl)methyl]amino]acetic acid (PubChem CID 65065447) has the molecular formula C11H11F2NO4 and a molecular weight of 259.21 g/mol. Its IUPAC name is 2-[carboxymethyl-[(3,4-difluorophenyl)methyl]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[(3,4-difluorophenyl)methyl]amino]acetic acid |
|---|---|
| PubChem CID | 65065447 |
| Molecular Formula | C11H11F2NO4 |
| Molecular Weight | 259.21 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 2-[carboxymethyl-[(3,4-difluorophenyl)methyl]amino]acetic acid |
| SMILES | O=C(O)CN(CC(=O)O)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H11F2NO4/c12-8-2-1-7(3-9(8)13)4-14(5-10(15)16)6-11(17)18/h1-3H,4-6H2,(H,15,16)(H,17,18) |
| InChIKey | XQBZKMILOQWXDG-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.21 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |