C12H15BrFNO3 — CID 81441647
2-[(4-bromo-3-fluorophenyl)methyl-(2-methoxyethyl)amino]acetic acid (PubChem CID 81441647) has the molecular formula C12H15BrFNO3 and a molecular weight of 320.16 g/mol. Its IUPAC name is 2-[(4-bromo-3-fluorophenyl)methyl-(2-methoxyethyl)amino]acetic acid.
| Compound Name | 2-[(4-bromo-3-fluorophenyl)methyl-(2-methoxyethyl)amino]acetic acid |
|---|---|
| PubChem CID | 81441647 |
| Molecular Formula | C12H15BrFNO3 |
| Molecular Weight | 320.16 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 2-[(4-bromo-3-fluorophenyl)methyl-(2-methoxyethyl)amino]acetic acid |
| SMILES | COCCN(CC(=O)O)Cc1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C12H15BrFNO3/c1-18-5-4-15(8-12(16)17)7-9-2-3-10(13)11(14)6-9/h2-3,6H,4-5,7-8H2,1H3,(H,16,17) |
| InChIKey | RPBQMUIURRXZBX-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.16 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |