C16H25NO3 — CID 39379496
2-[(4-tert-butylphenyl)methyl-(2-methoxyethyl)amino]acetic acid (PubChem CID 39379496) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is 2-[(4-tert-butylphenyl)methyl-(2-methoxyethyl)amino]acetic acid.
| Compound Name | 2-[(4-tert-butylphenyl)methyl-(2-methoxyethyl)amino]acetic acid |
|---|---|
| PubChem CID | 39379496 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 2-[(4-tert-butylphenyl)methyl-(2-methoxyethyl)amino]acetic acid |
| SMILES | COCCN(CC(=O)O)Cc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H25NO3/c1-16(2,3)14-7-5-13(6-8-14)11-17(9-10-20-4)12-15(18)19/h5-8H,9-12H2,1-4H3,(H,18,19) |
| InChIKey | XGTOKCLTLQIHEC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |