C16H25NO4 — CID 84758632
3-[4-[[bis(2-methoxyethyl)amino]methyl]phenyl]propanoic acid (PubChem CID 84758632) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is 3-[4-[[bis(2-methoxyethyl)amino]methyl]phenyl]propanoic acid.
| Compound Name | 3-[4-[[bis(2-methoxyethyl)amino]methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 84758632 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 3-[4-[[bis(2-methoxyethyl)amino]methyl]phenyl]propanoic acid |
| SMILES | COCCN(CCOC)Cc1ccc(CCC(=O)O)cc1 |
| InChI | InChI=1S/C16H25NO4/c1-20-11-9-17(10-12-21-2)13-15-5-3-14(4-6-15)7-8-16(18)19/h3-6H,7-13H2,1-2H3,(H,18,19) |
| InChIKey | YXQNRWXAQIUVGK-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |