C11H11F2NO3 — CID 62231927
3-[(3,4-difluorophenyl)methyl-methylamino]-3-oxopropanoic acid (PubChem CID 62231927) has the molecular formula C11H11F2NO3 and a molecular weight of 243.21 g/mol. Its IUPAC name is 3-[(3,4-difluorophenyl)methyl-methylamino]-3-oxopropanoic acid.
| Compound Name | 3-[(3,4-difluorophenyl)methyl-methylamino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 62231927 |
| Molecular Formula | C11H11F2NO3 |
| Molecular Weight | 243.21 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 3-[(3,4-difluorophenyl)methyl-methylamino]-3-oxopropanoic acid |
| SMILES | CN(Cc1ccc(F)c(F)c1)C(=O)CC(=O)O |
| InChI | InChI=1S/C11H11F2NO3/c1-14(10(15)5-11(16)17)6-7-2-3-8(12)9(13)4-7/h2-4H,5-6H2,1H3,(H,16,17) |
| InChIKey | HIDXRTXDTNSAKM-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.21 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|