C10H8F2N2O — CID 115172325
1-cyano-N-[(3,4-difluorophenyl)methyl]-N-methylformamide (PubChem CID 115172325) has the molecular formula C10H8F2N2O and a molecular weight of 210.18 g/mol. Its IUPAC name is 1-cyano-N-[(3,4-difluorophenyl)methyl]-N-methylformamide.
| Compound Name | 1-cyano-N-[(3,4-difluorophenyl)methyl]-N-methylformamide |
|---|---|
| PubChem CID | 115172325 |
| Molecular Formula | C10H8F2N2O |
| Molecular Weight | 210.18 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 1-cyano-N-[(3,4-difluorophenyl)methyl]-N-methylformamide |
| SMILES | CN(Cc1ccc(F)c(F)c1)C(=O)C#N |
| InChI | InChI=1S/C10H8F2N2O/c1-14(10(15)5-13)6-7-2-3-8(11)9(12)4-7/h2-4H,6H2,1H3 |
| InChIKey | JYPVTHYGWYEJOT-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.18 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'} |
|---|