C18H27FN2O3 — CID 110908152
2-(2-fluorophenyl)-1-[4-(2-hydroxy-3-propan-2-yloxypropyl)piperazin-1-yl]ethanone (PubChem CID 110908152) has the molecular formula C18H27FN2O3 and a molecular weight of 338.42 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-1-[4-(2-hydroxy-3-propan-2-yloxypropyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(2-fluorophenyl)-1-[4-(2-hydroxy-3-propan-2-yloxypropyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 110908152 |
| Molecular Formula | C18H27FN2O3 |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 2-(2-fluorophenyl)-1-[4-(2-hydroxy-3-propan-2-yloxypropyl)piperazin-1-yl]ethanone |
| SMILES | CC(C)OCC(O)CN1CCN(C(=O)Cc2ccccc2F)CC1 |
| InChI | InChI=1S/C18H27FN2O3/c1-14(2)24-13-16(22)12-20-7-9-21(10-8-20)18(23)11-15-5-3-4-6-17(15)19/h3-6,14,16,22H,7-13H2,1-2H3 |
| InChIKey | IFXSLKNJOUNEQN-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |