C17H27FN2O3 — CID 95352978
(2R)-1-[(2-fluorophenyl)methoxy]-3-[4-[(2R)-2-hydroxypropyl]piperazin-1-yl]propan-2-ol (PubChem CID 95352978) has the molecular formula C17H27FN2O3 and a molecular weight of 326.41 g/mol. Its IUPAC name is (2R)-1-[(2-fluorophenyl)methoxy]-3-[4-[(2R)-2-hydroxypropyl]piperazin-1-yl]propan-2-ol.
| Compound Name | (2R)-1-[(2-fluorophenyl)methoxy]-3-[4-[(2R)-2-hydroxypropyl]piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 95352978 |
| Molecular Formula | C17H27FN2O3 |
| Molecular Weight | 326.41 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | (2R)-1-[(2-fluorophenyl)methoxy]-3-[4-[(2R)-2-hydroxypropyl]piperazin-1-yl]propan-2-ol |
| SMILES | C[C@@H](O)CN1CCN(C[C@@H](O)COCc2ccccc2F)CC1 |
| InChI | InChI=1S/C17H27FN2O3/c1-14(21)10-19-6-8-20(9-7-19)11-16(22)13-23-12-15-4-2-3-5-17(15)18/h2-5,14,16,21-22H,6-13H2,1H3/t14-,16-/m1/s1 |
| InChIKey | AHISNTMKSFZAHV-GDBMZVCRSA-N |
| XLogP | 0.70 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.41 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |