C17H25FN2O3 — CID 134055072
1-[3-[(2-fluorophenyl)methoxy]-2-hydroxypropyl]-N-methylpiperidine-4-carboxamide (PubChem CID 134055072) has the molecular formula C17H25FN2O3 and a molecular weight of 324.40 g/mol. Its IUPAC name is 1-[3-[(2-fluorophenyl)methoxy]-2-hydroxypropyl]-N-methylpiperidine-4-carboxamide.
| Compound Name | 1-[3-[(2-fluorophenyl)methoxy]-2-hydroxypropyl]-N-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 134055072 |
| Molecular Formula | C17H25FN2O3 |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 1-[3-[(2-fluorophenyl)methoxy]-2-hydroxypropyl]-N-methylpiperidine-4-carboxamide |
| SMILES | CNC(=O)C1CCN(CC(O)COCc2ccccc2F)CC1 |
| InChI | InChI=1S/C17H25FN2O3/c1-19-17(22)13-6-8-20(9-7-13)10-15(21)12-23-11-14-4-2-3-5-16(14)18/h2-5,13,15,21H,6-12H2,1H3,(H,19,22) |
| InChIKey | IDAWRRADWXXQKA-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |