C21H26F2N2O2 — CID 92752913
(2R)-1-[(2-fluorophenyl)methoxy]-3-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]propan-2-ol (PubChem CID 92752913) has the molecular formula C21H26F2N2O2 and a molecular weight of 376.45 g/mol. Its IUPAC name is (2R)-1-[(2-fluorophenyl)methoxy]-3-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]propan-2-ol.
| Compound Name | (2R)-1-[(2-fluorophenyl)methoxy]-3-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 92752913 |
| Molecular Formula | C21H26F2N2O2 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | (2R)-1-[(2-fluorophenyl)methoxy]-3-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]propan-2-ol |
| SMILES | O[C@@H](COCc1ccccc1F)CN1CCN(Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H26F2N2O2/c22-19-7-5-17(6-8-19)13-24-9-11-25(12-10-24)14-20(26)16-27-15-18-3-1-2-4-21(18)23/h1-8,20,26H,9-16H2/t20-/m1/s1 |
| InChIKey | SDKCASIKAOPJMZ-HXUWFJFHSA-N |
| XLogP | 2.66 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |