C17H25FN2O2 — CID 95351563
3-(2-fluorophenyl)-1-[4-[(2R)-2-hydroxybutyl]piperazin-1-yl]propan-1-one (PubChem CID 95351563) has the molecular formula C17H25FN2O2 and a molecular weight of 308.40 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-1-[4-[(2R)-2-hydroxybutyl]piperazin-1-yl]propan-1-one.
| Compound Name | 3-(2-fluorophenyl)-1-[4-[(2R)-2-hydroxybutyl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 95351563 |
| Molecular Formula | C17H25FN2O2 |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | 3-(2-fluorophenyl)-1-[4-[(2R)-2-hydroxybutyl]piperazin-1-yl]propan-1-one |
| SMILES | CC[C@@H](O)CN1CCN(C(=O)CCc2ccccc2F)CC1 |
| InChI | InChI=1S/C17H25FN2O2/c1-2-15(21)13-19-9-11-20(12-10-19)17(22)8-7-14-5-3-4-6-16(14)18/h3-6,15,21H,2,7-13H2,1H3/t15-/m1/s1 |
| InChIKey | MPUBQHLOKBUEMC-OAHLLOKOSA-N |
| XLogP | 1.67 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |