C20H30FN3O2 — CID 110611618
1-[4-[3-(diethylamino)propanoyl]piperazin-1-yl]-3-(2-fluorophenyl)propan-1-one (PubChem CID 110611618) has the molecular formula C20H30FN3O2 and a molecular weight of 363.48 g/mol. Its IUPAC name is 1-[4-[3-(diethylamino)propanoyl]piperazin-1-yl]-3-(2-fluorophenyl)propan-1-one.
| Compound Name | 1-[4-[3-(diethylamino)propanoyl]piperazin-1-yl]-3-(2-fluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 110611618 |
| Molecular Formula | C20H30FN3O2 |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | 1-[4-[3-(diethylamino)propanoyl]piperazin-1-yl]-3-(2-fluorophenyl)propan-1-one |
| SMILES | CCN(CC)CCC(=O)N1CCN(C(=O)CCc2ccccc2F)CC1 |
| InChI | InChI=1S/C20H30FN3O2/c1-3-22(4-2)12-11-20(26)24-15-13-23(14-16-24)19(25)10-9-17-7-5-6-8-18(17)21/h5-8H,3-4,9-16H2,1-2H3 |
| InChIKey | QLNIUPMXOILKJI-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |