C16H22FNO3 — CID 112534879
1-(4,4-dimethoxypiperidin-1-yl)-3-(2-fluorophenyl)propan-1-one (PubChem CID 112534879) has the molecular formula C16H22FNO3 and a molecular weight of 295.35 g/mol. Its IUPAC name is 1-(4,4-dimethoxypiperidin-1-yl)-3-(2-fluorophenyl)propan-1-one.
| Compound Name | 1-(4,4-dimethoxypiperidin-1-yl)-3-(2-fluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 112534879 |
| Molecular Formula | C16H22FNO3 |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 1-(4,4-dimethoxypiperidin-1-yl)-3-(2-fluorophenyl)propan-1-one |
| SMILES | COC1(OC)CCN(C(=O)CCc2ccccc2F)CC1 |
| InChI | InChI=1S/C16H22FNO3/c1-20-16(21-2)9-11-18(12-10-16)15(19)8-7-13-5-3-4-6-14(13)17/h3-6H,7-12H2,1-2H3 |
| InChIKey | JDXFGSSKUYIEQA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|