C17H25NO4 — CID 84579262
1-(4,4-dimethoxypiperidin-1-yl)-4-phenoxybutan-1-one (PubChem CID 84579262) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is 1-(4,4-dimethoxypiperidin-1-yl)-4-phenoxybutan-1-one.
| Compound Name | 1-(4,4-dimethoxypiperidin-1-yl)-4-phenoxybutan-1-one |
|---|---|
| PubChem CID | 84579262 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 1-(4,4-dimethoxypiperidin-1-yl)-4-phenoxybutan-1-one |
| SMILES | COC1(OC)CCN(C(=O)CCCOc2ccccc2)CC1 |
| InChI | InChI=1S/C17H25NO4/c1-20-17(21-2)10-12-18(13-11-17)16(19)9-6-14-22-15-7-4-3-5-8-15/h3-5,7-8H,6,9-14H2,1-2H3 |
| InChIKey | HRLLAQYPPBAHIV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|