C17H25NO2 — CID 27473703
1-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-4-phenoxybutan-1-one (PubChem CID 27473703) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is 1-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-4-phenoxybutan-1-one.
| Compound Name | 1-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-4-phenoxybutan-1-one |
|---|---|
| PubChem CID | 27473703 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 1-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-4-phenoxybutan-1-one |
| SMILES | C[C@@H]1C[C@H](C)CN(C(=O)CCCOc2ccccc2)C1 |
| InChI | InChI=1S/C17H25NO2/c1-14-11-15(2)13-18(12-14)17(19)9-6-10-20-16-7-4-3-5-8-16/h3-5,7-8,14-15H,6,9-13H2,1-2H3/t14-,15+ |
| InChIKey | RWTDQLZTAINUSS-GASCZTMLSA-N |
| XLogP | 3.35 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|