C16H26ClN3O2 — CID 111422245
1-[4-[(6-chloro-3-pyridinyl)methyl]piperazin-1-yl]-3-propan-2-yloxypropan-2-ol (PubChem CID 111422245) has the molecular formula C16H26ClN3O2 and a molecular weight of 327.86 g/mol. Its IUPAC name is 1-[4-[(6-chloro-3-pyridinyl)methyl]piperazin-1-yl]-3-propan-2-yloxypropan-2-ol.
| Compound Name | 1-[4-[(6-chloro-3-pyridinyl)methyl]piperazin-1-yl]-3-propan-2-yloxypropan-2-ol |
|---|---|
| PubChem CID | 111422245 |
| Molecular Formula | C16H26ClN3O2 |
| Molecular Weight | 327.86 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 1-[4-[(6-chloro-3-pyridinyl)methyl]piperazin-1-yl]-3-propan-2-yloxypropan-2-ol |
| SMILES | CC(C)OCC(O)CN1CCN(Cc2ccc(Cl)nc2)CC1 |
| InChI | InChI=1S/C16H26ClN3O2/c1-13(2)22-12-15(21)11-20-7-5-19(6-8-20)10-14-3-4-16(17)18-9-14/h3-4,9,13,15,21H,5-8,10-12H2,1-2H3 |
| InChIKey | SXQWTWXCYUCBQI-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 48.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.86 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|