C16H25OZn- — CID 11289501
(E,1S)-4,4-dimethyl-1-(4-methylphenyl)pent-2-en-1-ol;ethane;zinc (PubChem CID 11289501) has the molecular formula C16H25OZn- and a molecular weight of 298.77 g/mol. Its IUPAC name is (E,1S)-4,4-dimethyl-1-(4-methylphenyl)pent-2-en-1-ol;ethane;zinc.
| Compound Name | (E,1S)-4,4-dimethyl-1-(4-methylphenyl)pent-2-en-1-ol;ethane;zinc |
|---|---|
| PubChem CID | 11289501 |
| Molecular Formula | C16H25OZn- |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | (E,1S)-4,4-dimethyl-1-(4-methylphenyl)pent-2-en-1-ol;ethane;zinc |
| SMILES | Cc1ccc([C@@H](O)/C=C/C(C)(C)C)cc1.[CH2-]C.[Zn] |
| InChI | InChI=1S/C14H20O.C2H5.Zn/c1-11-5-7-12(8-6-11)13(15)9-10-14(2,3)4;1-2;/h5-10,13,15H,1-4H3;1H2,2H3;/q;-1;/b10-9+;;/t13-;;/m0../s1 |
| InChIKey | XACLXCFOCRBXEH-XDNDIPBESA-N |
| XLogP | 4.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|