C12H18O2 — CID 54566569
(1R,2S)-2-methyl-1-(4-methylphenyl)butane-1,2-diol (PubChem CID 54566569) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is (1R,2S)-2-methyl-1-(4-methylphenyl)butane-1,2-diol.
| Compound Name | (1R,2S)-2-methyl-1-(4-methylphenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 54566569 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | (1R,2S)-2-methyl-1-(4-methylphenyl)butane-1,2-diol |
| SMILES | CC[C@](C)(O)[C@H](O)c1ccc(C)cc1 |
| InChI | InChI=1S/C12H18O2/c1-4-12(3,14)11(13)10-7-5-9(2)6-8-10/h5-8,11,13-14H,4H2,1-3H3/t11-,12+/m1/s1 |
| InChIKey | ZUFWILNYJDZAPQ-NEPJUHHUSA-N |
| XLogP | 2.19 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |