About (E,1S)-4,4-dimethyl-1-[4-(trifluoromethyl)phenyl]pent-2-en-1-ol;ethane;zinc
(E,1S)-4,4-dimethyl-1-[4-(trifluoromethyl)phenyl]pent-2-en-1-ol;ethane;zinc (PubChem CID 11291097) has the molecular formula C16H22F3OZn-
and a molecular weight of 352.74 g/mol. Its IUPAC name is (E,1S)-4,4-dimethyl-1-[4-(trifluoromethyl)phenyl]pent-2-en-1-ol;ethane;zinc.
Molecular Properties
| Compound Name | (E,1S)-4,4-dimethyl-1-[4-(trifluoromethyl)phenyl]pent-2-en-1-ol;ethane;zinc |
| PubChem CID | 11291097 |
| Molecular Formula | C16H22F3OZn- |
| Molecular Weight | 352.74 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | (E,1S)-4,4-dimethyl-1-[4-(trifluoromethyl)phenyl]pent-2-en-1-ol;ethane;zinc |
| SMILES | CC(C)(C)/C=C/[C@H](O)c1ccc(C(F)(F)F)cc1.[CH2-]C.[Zn] |
| InChI | InChI=1S/C14H17F3O.C2H5.Zn/c1-13(2,3)9-8-12(18)10-4-6-11(7-5-10)14(15,16)17;1-2;/h4-9,12,18H,1-3H3;1H2,2H3;/q;-1;/b9-8+;;/t12-;;/m0../s1 |
| InChIKey | GFEQEVCIGXCWDF-ZCJJQMOWSA-N |
| XLogP | 5.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 352.74 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E,1S)-4,4-dimethyl-1-[4-(trifluoromethyl)phenyl]pent-2-en-1-ol;ethane;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,1S)-4,4-dimethyl-1-[4-(trifluoromethyl)phenyl]pent-2-en-1-ol;ethane;zinc?
The IUPAC name of (E,1S)-4,4-dimethyl-1-[4-(trifluoromethyl)phenyl]pent-2-en-1-ol;ethane;zinc (CID 11291097) is (E,1S)-4,4-dimethyl-1-[4-(trifluoromethyl)phenyl]pent-2-en-1-ol;ethane;zinc.
What is the SMILES notation for (E,1S)-4,4-dimethyl-1-[4-(trifluoromethyl)phenyl]pent-2-en-1-ol;ethane;zinc?
The canonical SMILES for (E,1S)-4,4-dimethyl-1-[4-(trifluoromethyl)phenyl]pent-2-en-1-ol;ethane;zinc is CC(C)(C)/C=C/[C@H](O)c1ccc(C(F)(F)F)cc1.[CH2-]C.[Zn].
What is the InChIKey of (E,1S)-4,4-dimethyl-1-[4-(trifluoromethyl)phenyl]pent-2-en-1-ol;ethane;zinc?
The InChIKey is GFEQEVCIGXCWDF-ZCJJQMOWSA-N. The full InChI is InChI=1S/C14H17F3O.C2H5.Zn/c1-13(2,3)9-8-12(18)10-4-6-11(7-5-10)14(15,16)17;1-2;/h4-9,12,18H,1-3H3;1H2,2H3;/q;-1;/b9-8+;;/t12-;;/m0../s1.
What are the key properties of (E,1S)-4,4-dimethyl-1-[4-(trifluoromethyl)phenyl]pent-2-en-1-ol;ethane;zinc?
(E,1S)-4,4-dimethyl-1-[4-(trifluoromethyl)phenyl]pent-2-en-1-ol;ethane;zinc has a molecular weight of 352.74 g/mol, XLogP of 5.18, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E,1S)-4,4-dimethyl-1-[4-(trifluoromethyl)phenyl]pent-2-en-1-ol;ethane;zinc is sourced from PubChem (CID 11291097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).