C16H22F3OZn- — CID 11291097
(E,1S)-4,4-dimethyl-1-[4-(trifluoromethyl)phenyl]pent-2-en-1-ol;ethane;zinc (PubChem CID 11291097) has the molecular formula C16H22F3OZn- and a molecular weight of 352.74 g/mol. Its IUPAC name is (E,1S)-4,4-dimethyl-1-[4-(trifluoromethyl)phenyl]pent-2-en-1-ol;ethane;zinc.
| Compound Name | (E,1S)-4,4-dimethyl-1-[4-(trifluoromethyl)phenyl]pent-2-en-1-ol;ethane;zinc |
|---|---|
| PubChem CID | 11291097 |
| Molecular Formula | C16H22F3OZn- |
| Molecular Weight | 352.74 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | (E,1S)-4,4-dimethyl-1-[4-(trifluoromethyl)phenyl]pent-2-en-1-ol;ethane;zinc |
| SMILES | CC(C)(C)/C=C/[C@H](O)c1ccc(C(F)(F)F)cc1.[CH2-]C.[Zn] |
| InChI | InChI=1S/C14H17F3O.C2H5.Zn/c1-13(2,3)9-8-12(18)10-4-6-11(7-5-10)14(15,16)17;1-2;/h4-9,12,18H,1-3H3;1H2,2H3;/q;-1;/b9-8+;;/t12-;;/m0../s1 |
| InChIKey | GFEQEVCIGXCWDF-ZCJJQMOWSA-N |
| XLogP | 5.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.74 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|