C32H22F12O4 — CID 162540226
(2R,3R)-1,1,4,4-tetrakis[4-(trifluoromethyl)phenyl]butane-1,2,3,4-tetrol (PubChem CID 162540226) has the molecular formula C32H22F12O4 and a molecular weight of 698.50 g/mol. Its IUPAC name is (2R,3R)-1,1,4,4-tetrakis[4-(trifluoromethyl)phenyl]butane-1,2,3,4-tetrol.
| Compound Name | (2R,3R)-1,1,4,4-tetrakis[4-(trifluoromethyl)phenyl]butane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 162540226 |
| Molecular Formula | C32H22F12O4 |
| Molecular Weight | 698.50 g/mol |
| Exact Mass | 698.13 |
| IUPAC Name | (2R,3R)-1,1,4,4-tetrakis[4-(trifluoromethyl)phenyl]butane-1,2,3,4-tetrol |
| SMILES | O[C@H]([C@@H](O)C(O)(c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1)C(O)(c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C32H22F12O4/c33-29(34,35)21-9-1-17(2-10-21)27(47,18-3-11-22(12-4-18)30(36,37)38)25(45)26(46)28(48,19-5-13-23(14-6-19)31(39,40)41)20-7-15-24(16-8-20)32(42,43)44/h1-16,25-26,45-48H/t25-,26-/m1/s1 |
| InChIKey | AUUAHKUEILHSON-CLJLJLNGSA-N |
| XLogP | 7.66 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.50 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |