C18H21F3OSi — CID 101475604
1-[4-(trifluoromethyl)phenyl]-1-(4-trimethylsilylphenyl)ethanol (PubChem CID 101475604) has the molecular formula C18H21F3OSi and a molecular weight of 338.45 g/mol. Its IUPAC name is 1-[4-(trifluoromethyl)phenyl]-1-(4-trimethylsilylphenyl)ethanol.
| Compound Name | 1-[4-(trifluoromethyl)phenyl]-1-(4-trimethylsilylphenyl)ethanol |
|---|---|
| PubChem CID | 101475604 |
| Molecular Formula | C18H21F3OSi |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 1-[4-(trifluoromethyl)phenyl]-1-(4-trimethylsilylphenyl)ethanol |
| SMILES | CC(O)(c1ccc(C(F)(F)F)cc1)c1ccc([Si](C)(C)C)cc1 |
| InChI | InChI=1S/C18H21F3OSi/c1-17(22,13-5-7-15(8-6-13)18(19,20)21)14-9-11-16(12-10-14)23(2,3)4/h5-12,22H,1-4H3 |
| InChIKey | BMEKASCBNJJBIL-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|