C14H25F3O2Si3 — CID 102084462
trimethyl-[methyl-[4-(trifluoromethyl)phenyl]-trimethylsilyloxysilyl]oxysilane (PubChem CID 102084462) has the molecular formula C14H25F3O2Si3 and a molecular weight of 366.60 g/mol. Its IUPAC name is trimethyl-[methyl-[4-(trifluoromethyl)phenyl]-trimethylsilyloxysilyl]oxysilane.
| Compound Name | trimethyl-[methyl-[4-(trifluoromethyl)phenyl]-trimethylsilyloxysilyl]oxysilane |
|---|---|
| PubChem CID | 102084462 |
| Molecular Formula | C14H25F3O2Si3 |
| Molecular Weight | 366.60 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | trimethyl-[methyl-[4-(trifluoromethyl)phenyl]-trimethylsilyloxysilyl]oxysilane |
| SMILES | C[Si](C)(C)O[Si](C)(O[Si](C)(C)C)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H25F3O2Si3/c1-20(2,3)18-22(7,19-21(4,5)6)13-10-8-12(9-11-13)14(15,16)17/h8-11H,1-7H3 |
| InChIKey | WLRZXESKRUZFBS-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.60 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|