C20H41F3O2Si5 — CID 139197816
hydroxy-[[4-(trifluoromethyl)phenyl]-bis(trimethylsilyl)methyl]-trimethylsilyl-trimethylsilyloxysilane (PubChem CID 139197816) has the molecular formula C20H41F3O2Si5 and a molecular weight of 510.97 g/mol. Its IUPAC name is hydroxy-[[4-(trifluoromethyl)phenyl]-bis(trimethylsilyl)methyl]-trimethylsilyl-trimethylsilyloxysilane.
| Compound Name | hydroxy-[[4-(trifluoromethyl)phenyl]-bis(trimethylsilyl)methyl]-trimethylsilyl-trimethylsilyloxysilane |
|---|---|
| PubChem CID | 139197816 |
| Molecular Formula | C20H41F3O2Si5 |
| Molecular Weight | 510.97 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | hydroxy-[[4-(trifluoromethyl)phenyl]-bis(trimethylsilyl)methyl]-trimethylsilyl-trimethylsilyloxysilane |
| SMILES | C[Si](C)(C)O[Si@@](O)(C(c1ccc(C(F)(F)F)cc1)([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C20H41F3O2Si5/c1-26(2,3)20(27(4,5)6,18-15-13-17(14-16-18)19(21,22)23)30(24,29(10,11)12)25-28(7,8)9/h13-16,24H,1-12H3/t30-/m0/s1 |
| InChIKey | HLSQUXAQQVSTQZ-PMERELPUSA-N |
| XLogP | 6.94 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.97 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|