C15H18ClF3O — CID 122212966
(E,1S)-7-chloro-3-methyl-1-[4-(trifluoromethyl)phenyl]hept-2-en-1-ol (PubChem CID 122212966) has the molecular formula C15H18ClF3O and a molecular weight of 306.76 g/mol. Its IUPAC name is (E,1S)-7-chloro-3-methyl-1-[4-(trifluoromethyl)phenyl]hept-2-en-1-ol.
| Compound Name | (E,1S)-7-chloro-3-methyl-1-[4-(trifluoromethyl)phenyl]hept-2-en-1-ol |
|---|---|
| PubChem CID | 122212966 |
| Molecular Formula | C15H18ClF3O |
| Molecular Weight | 306.76 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | (E,1S)-7-chloro-3-methyl-1-[4-(trifluoromethyl)phenyl]hept-2-en-1-ol |
| SMILES | C/C(=C\[C@H](O)c1ccc(C(F)(F)F)cc1)CCCCCl |
| InChI | InChI=1S/C15H18ClF3O/c1-11(4-2-3-9-16)10-14(20)12-5-7-13(8-6-12)15(17,18)19/h5-8,10,14,20H,2-4,9H2,1H3/b11-10+/t14-/m0/s1 |
| InChIKey | JOBGOBHPHFGTHV-VNDWYCCKSA-N |
| XLogP | 5.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.76 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|