About dichloromethane;1-[4-[hydroxy-[4-(trifluoromethyl)phenyl]methyl]phenyl]ethanone
dichloromethane;1-[4-[hydroxy-[4-(trifluoromethyl)phenyl]methyl]phenyl]ethanone (PubChem CID 90933922) has the molecular formula C17H15Cl2F3O2
and a molecular weight of 379.21 g/mol. Its IUPAC name is dichloromethane;1-[4-[hydroxy-[4-(trifluoromethyl)phenyl]methyl]phenyl]ethanone.
Molecular Properties
| Compound Name | dichloromethane;1-[4-[hydroxy-[4-(trifluoromethyl)phenyl]methyl]phenyl]ethanone |
| PubChem CID | 90933922 |
| Molecular Formula | C17H15Cl2F3O2 |
| Molecular Weight | 379.21 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | dichloromethane;1-[4-[hydroxy-[4-(trifluoromethyl)phenyl]methyl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(C(O)c2ccc(C(F)(F)F)cc2)cc1.ClCCl |
| InChI | InChI=1S/C16H13F3O2.CH2Cl2/c1-10(20)11-2-4-12(5-3-11)15(21)13-6-8-14(9-7-13)16(17,18)19;2-1-3/h2-9,15,21H,1H3;1H2 |
| InChIKey | PUZDATSCMVXYHQ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.21 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze dichloromethane;1-[4-[hydroxy-[4-(trifluoromethyl)phenyl]methyl]phenyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloromethane;1-[4-[hydroxy-[4-(trifluoromethyl)phenyl]methyl]phenyl]ethanone?
The IUPAC name of dichloromethane;1-[4-[hydroxy-[4-(trifluoromethyl)phenyl]methyl]phenyl]ethanone (CID 90933922) is dichloromethane;1-[4-[hydroxy-[4-(trifluoromethyl)phenyl]methyl]phenyl]ethanone.
What is the SMILES notation for dichloromethane;1-[4-[hydroxy-[4-(trifluoromethyl)phenyl]methyl]phenyl]ethanone?
The canonical SMILES for dichloromethane;1-[4-[hydroxy-[4-(trifluoromethyl)phenyl]methyl]phenyl]ethanone is CC(=O)c1ccc(C(O)c2ccc(C(F)(F)F)cc2)cc1.ClCCl.
What is the InChIKey of dichloromethane;1-[4-[hydroxy-[4-(trifluoromethyl)phenyl]methyl]phenyl]ethanone?
The InChIKey is PUZDATSCMVXYHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13F3O2.CH2Cl2/c1-10(20)11-2-4-12(5-3-11)15(21)13-6-8-14(9-7-13)16(17,18)19;2-1-3/h2-9,15,21H,1H3;1H2.
What are the key properties of dichloromethane;1-[4-[hydroxy-[4-(trifluoromethyl)phenyl]methyl]phenyl]ethanone?
dichloromethane;1-[4-[hydroxy-[4-(trifluoromethyl)phenyl]methyl]phenyl]ethanone has a molecular weight of 379.21 g/mol, XLogP of 5.41, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dichloromethane;1-[4-[hydroxy-[4-(trifluoromethyl)phenyl]methyl]phenyl]ethanone is sourced from PubChem (CID 90933922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).