C10H8F4O — CID 84724573
1-[4-(1,1,2,2-tetrafluoroethyl)phenyl]ethanone (PubChem CID 84724573) has the molecular formula C10H8F4O and a molecular weight of 220.17 g/mol. Its IUPAC name is 1-[4-(1,1,2,2-tetrafluoroethyl)phenyl]ethanone.
| Compound Name | 1-[4-(1,1,2,2-tetrafluoroethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 84724573 |
| Molecular Formula | C10H8F4O |
| Molecular Weight | 220.17 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 1-[4-(1,1,2,2-tetrafluoroethyl)phenyl]ethanone |
| SMILES | CC(=O)c1ccc(C(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C10H8F4O/c1-6(15)7-2-4-8(5-3-7)10(13,14)9(11)12/h2-5,9H,1H3 |
| InChIKey | YECPBOONJSJQJZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.17 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|