C31H22F6O4 — CID 56999322
1-[4-[4-[1-[4-(4-acetylphenoxy)phenyl]-1,2,2,3,3,3-hexafluoropropyl]phenoxy]phenyl]ethanone (PubChem CID 56999322) has the molecular formula C31H22F6O4 and a molecular weight of 572.50 g/mol. Its IUPAC name is 1-[4-[4-[1-[4-(4-acetylphenoxy)phenyl]-1,2,2,3,3,3-hexafluoropropyl]phenoxy]phenyl]ethanone.
| Compound Name | 1-[4-[4-[1-[4-(4-acetylphenoxy)phenyl]-1,2,2,3,3,3-hexafluoropropyl]phenoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 56999322 |
| Molecular Formula | C31H22F6O4 |
| Molecular Weight | 572.50 g/mol |
| Exact Mass | 572.14 |
| IUPAC Name | 1-[4-[4-[1-[4-(4-acetylphenoxy)phenyl]-1,2,2,3,3,3-hexafluoropropyl]phenoxy]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(Oc2ccc(C(F)(c3ccc(Oc4ccc(C(C)=O)cc4)cc3)C(F)(F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C31H22F6O4/c1-19(38)21-3-11-25(12-4-21)40-27-15-7-23(8-16-27)29(32,30(33,34)31(35,36)37)24-9-17-28(18-10-24)41-26-13-5-22(6-14-26)20(2)39/h3-18H,1-2H3 |
| InChIKey | HUXIPYWDESMYSU-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.50 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|