C12H11F5O2 — CID 156763482
1-[4-(3,3,4,4,4-pentafluoro-1-hydroxybutyl)phenyl]ethanone (PubChem CID 156763482) has the molecular formula C12H11F5O2 and a molecular weight of 282.21 g/mol. Its IUPAC name is 1-[4-(3,3,4,4,4-pentafluoro-1-hydroxybutyl)phenyl]ethanone.
| Compound Name | 1-[4-(3,3,4,4,4-pentafluoro-1-hydroxybutyl)phenyl]ethanone |
|---|---|
| PubChem CID | 156763482 |
| Molecular Formula | C12H11F5O2 |
| Molecular Weight | 282.21 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 1-[4-(3,3,4,4,4-pentafluoro-1-hydroxybutyl)phenyl]ethanone |
| SMILES | CC(=O)c1ccc(C(O)CC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H11F5O2/c1-7(18)8-2-4-9(5-3-8)10(19)6-11(13,14)12(15,16)17/h2-5,10,19H,6H2,1H3 |
| InChIKey | FQZTZXUYBCSFSP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.21 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|