C16H13F11O2 — CID 156763228
1-[4-(3,3,4,4,5,5,6,6,7,7,7-undecafluoro-1-methoxyheptyl)phenyl]ethanone (PubChem CID 156763228) has the molecular formula C16H13F11O2 and a molecular weight of 446.26 g/mol. Its IUPAC name is 1-[4-(3,3,4,4,5,5,6,6,7,7,7-undecafluoro-1-methoxyheptyl)phenyl]ethanone.
| Compound Name | 1-[4-(3,3,4,4,5,5,6,6,7,7,7-undecafluoro-1-methoxyheptyl)phenyl]ethanone |
|---|---|
| PubChem CID | 156763228 |
| Molecular Formula | C16H13F11O2 |
| Molecular Weight | 446.26 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | 1-[4-(3,3,4,4,5,5,6,6,7,7,7-undecafluoro-1-methoxyheptyl)phenyl]ethanone |
| SMILES | COC(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C16H13F11O2/c1-8(28)9-3-5-10(6-4-9)11(29-2)7-12(17,18)13(19,20)14(21,22)15(23,24)16(25,26)27/h3-6,11H,7H2,1-2H3 |
| InChIKey | NUHRCWJHFUXBLZ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.26 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|