C19H19F13O — CID 156765107
1-tert-butyl-4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-methoxyoctyl)benzene (PubChem CID 156765107) has the molecular formula C19H19F13O and a molecular weight of 510.33 g/mol. Its IUPAC name is 1-tert-butyl-4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-methoxyoctyl)benzene.
| Compound Name | 1-tert-butyl-4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-methoxyoctyl)benzene |
|---|---|
| PubChem CID | 156765107 |
| Molecular Formula | C19H19F13O |
| Molecular Weight | 510.33 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | 1-tert-butyl-4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-methoxyoctyl)benzene |
| SMILES | COC(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H19F13O/c1-13(2,3)11-7-5-10(6-8-11)12(33-4)9-14(20,21)15(22,23)16(24,25)17(26,27)18(28,29)19(30,31)32/h5-8,12H,9H2,1-4H3 |
| InChIKey | UQRWGYISWLEBMA-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.33 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|