C18H13F17O — CID 156764147
1-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-1-methoxydecyl)-3-methylbenzene (PubChem CID 156764147) has the molecular formula C18H13F17O and a molecular weight of 568.27 g/mol. Its IUPAC name is 1-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-1-methoxydecyl)-3-methylbenzene.
| Compound Name | 1-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-1-methoxydecyl)-3-methylbenzene |
|---|---|
| PubChem CID | 156764147 |
| Molecular Formula | C18H13F17O |
| Molecular Weight | 568.27 g/mol |
| Exact Mass | 568.07 |
| IUPAC Name | 1-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-1-methoxydecyl)-3-methylbenzene |
| SMILES | COC(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1cccc(C)c1 |
| InChI | InChI=1S/C18H13F17O/c1-8-4-3-5-9(6-8)10(36-2)7-11(19,20)12(21,22)13(23,24)14(25,26)15(27,28)16(29,30)17(31,32)18(33,34)35/h3-6,10H,7H2,1-2H3 |
| InChIKey | GQFGLZCYXQOWED-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.27 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|