C17H18F9NO3 — CID 175048525
4-(1-tert-butylperoxy-3,3,4,4,5,5,6,6,6-nonafluorohexyl)benzamide (PubChem CID 175048525) has the molecular formula C17H18F9NO3 and a molecular weight of 455.32 g/mol. Its IUPAC name is 4-(1-tert-butylperoxy-3,3,4,4,5,5,6,6,6-nonafluorohexyl)benzamide.
| Compound Name | 4-(1-tert-butylperoxy-3,3,4,4,5,5,6,6,6-nonafluorohexyl)benzamide |
|---|---|
| PubChem CID | 175048525 |
| Molecular Formula | C17H18F9NO3 |
| Molecular Weight | 455.32 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 4-(1-tert-butylperoxy-3,3,4,4,5,5,6,6,6-nonafluorohexyl)benzamide |
| SMILES | CC(C)(C)OOC(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C17H18F9NO3/c1-13(2,3)30-29-11(9-4-6-10(7-5-9)12(27)28)8-14(18,19)15(20,21)16(22,23)17(24,25)26/h4-7,11H,8H2,1-3H3,(H2,27,28) |
| InChIKey | RVYZUHOQIGXMNN-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.32 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|