C22H17F21O2 — CID 175043636
(1-tert-butylperoxy-3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododecyl)benzene (PubChem CID 175043636) has the molecular formula C22H17F21O2 and a molecular weight of 712.33 g/mol. Its IUPAC name is (1-tert-butylperoxy-3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododecyl)benzene.
| Compound Name | (1-tert-butylperoxy-3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododecyl)benzene |
|---|---|
| PubChem CID | 175043636 |
| Molecular Formula | C22H17F21O2 |
| Molecular Weight | 712.33 g/mol |
| Exact Mass | 712.09 |
| IUPAC Name | (1-tert-butylperoxy-3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododecyl)benzene |
| SMILES | CC(C)(C)OOC(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C22H17F21O2/c1-12(2,3)45-44-11(10-7-5-4-6-8-10)9-13(23,24)14(25,26)15(27,28)16(29,30)17(31,32)18(33,34)19(35,36)20(37,38)21(39,40)22(41,42)43/h4-8,11H,9H2,1-3H3 |
| InChIKey | MPUUXTQMECBMAY-UHFFFAOYSA-N |
| XLogP | 10.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.33 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|